C16H15FNO3S2- — CID 7655450
(2R)-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate (PubChem CID 7655450) has the molecular formula C16H15FNO3S2- and a molecular weight of 352.43 g/mol. Its IUPAC name is (2R)-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate.
| Compound Name | (2R)-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
|---|---|
| PubChem CID | 7655450 |
| Molecular Formula | C16H15FNO3S2- |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.05 |
| IUPAC Name | (2R)-2-[(5Z)-5-[(3-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]hexanoate |
| SMILES | CCCC[C@H](C(=O)[O-])N1C(=O)/C(=C/c2cccc(F)c2)SC1=S |
| InChI | InChI=1S/C16H16FNO3S2/c1-2-3-7-12(15(20)21)18-14(19)13(23-16(18)22)9-10-5-4-6-11(17)8-10/h4-6,8-9,12H,2-3,7H2,1H3,(H,20,21)/p-1/b13-9-/t12-/m1/s1 |
| InChIKey | RNEXDLAIOIXXPD-FNWMBBJUSA-M |
| XLogP | 2.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|