C6H12N2O5 — CID 76553708
3-hydrazinylidene-6-(hydroxymethyl)oxane-2,4,5-triol (PubChem CID 76553708) has the molecular formula C6H12N2O5 and a molecular weight of 192.17 g/mol. Its IUPAC name is 3-hydrazinylidene-6-(hydroxymethyl)oxane-2,4,5-triol.
| Compound Name | 3-hydrazinylidene-6-(hydroxymethyl)oxane-2,4,5-triol |
|---|---|
| PubChem CID | 76553708 |
| Molecular Formula | C6H12N2O5 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 3-hydrazinylidene-6-(hydroxymethyl)oxane-2,4,5-triol |
| SMILES | NN=C1C(O)OC(CO)C(O)C1O |
| InChI | InChI=1S/C6H12N2O5/c7-8-3-5(11)4(10)2(1-9)13-6(3)12/h2,4-6,9-12H,1,7H2 |
| InChIKey | GDPFHHFAVQDZFP-UHFFFAOYSA-N |
| XLogP | -3.27 |
| TPSA | 128.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -3.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|