C12H10BrNO3 — CID 76556882
3-(3-bromo-4,5-dimethoxyphenyl)-2-formylprop-2-enenitrile (PubChem CID 76556882) has the molecular formula C12H10BrNO3 and a molecular weight of 296.12 g/mol. Its IUPAC name is 3-(3-bromo-4,5-dimethoxyphenyl)-2-formylprop-2-enenitrile.
| Compound Name | 3-(3-bromo-4,5-dimethoxyphenyl)-2-formylprop-2-enenitrile |
|---|---|
| PubChem CID | 76556882 |
| Molecular Formula | C12H10BrNO3 |
| Molecular Weight | 296.12 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | 3-(3-bromo-4,5-dimethoxyphenyl)-2-formylprop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)C=O)cc(Br)c1OC |
| InChI | InChI=1S/C12H10BrNO3/c1-16-11-5-8(3-9(6-14)7-15)4-10(13)12(11)17-2/h3-5,7H,1-2H3 |
| InChIKey | IGUSABFLKSOPDX-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 59.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.12 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|