About 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane
1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane (PubChem CID 76564100) has the molecular formula C16H14F3N3S2
and a molecular weight of 369.44 g/mol. Its IUPAC name is 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane.
Molecular Properties
| Compound Name | 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane |
| PubChem CID | 76564100 |
| Molecular Formula | C16H14F3N3S2 |
| Molecular Weight | 369.44 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)S(C)=Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14F3N3S2/c1-10(11-7-8-14(20-9-11)16(17,18)19)24(2)22-15-21-12-5-3-4-6-13(12)23-15/h3-10H,1-2H3 |
| InChIKey | GEHQXPGESLLZFH-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 369.44 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane?
The IUPAC name of 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane (CID 76564100) is 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane.
What is the SMILES notation for 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane?
The canonical SMILES for 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane is CC(c1ccc(C(F)(F)F)nc1)S(C)=Nc1nc2ccccc2s1.
What is the InChIKey of 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane?
The InChIKey is GEHQXPGESLLZFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14F3N3S2/c1-10(11-7-8-14(20-9-11)16(17,18)19)24(2)22-15-21-12-5-3-4-6-13(12)23-15/h3-10H,1-2H3.
What are the key properties of 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane?
1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane has a molecular weight of 369.44 g/mol, XLogP of 5.53, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-benzothiazol-2-ylimino-methyl-[1-[6-(trifluoromethyl)-3-pyridinyl]ethyl]-λ4-sulfane is sourced from PubChem (CID 76564100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).