C16H14F3N3OS2 — CID 91545992
N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-benzothiazol-2-amine (PubChem CID 91545992) has the molecular formula C16H14F3N3OS2 and a molecular weight of 385.44 g/mol. Its IUPAC name is N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-benzothiazol-2-amine.
| Compound Name | N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 91545992 |
| Molecular Formula | C16H14F3N3OS2 |
| Molecular Weight | 385.44 g/mol |
| Exact Mass | 385.05 |
| IUPAC Name | N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-benzothiazol-2-amine |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)=S(C)(=O)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H14F3N3OS2/c1-10(11-7-8-14(20-9-11)16(17,18)19)25(2,23)22-15-21-12-5-3-4-6-13(12)24-15/h3-9H,1-2H3,(H,21,22,23) |
| InChIKey | UNJFZLRKBGRPNQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.44 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|