C14H13F4N3OS — CID 91616041
5-fluoro-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]pyridin-2-amine (PubChem CID 91616041) has the molecular formula C14H13F4N3OS and a molecular weight of 347.34 g/mol. Its IUPAC name is 5-fluoro-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]pyridin-2-amine.
| Compound Name | 5-fluoro-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]pyridin-2-amine |
|---|---|
| PubChem CID | 91616041 |
| Molecular Formula | C14H13F4N3OS |
| Molecular Weight | 347.34 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | 5-fluoro-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]pyridin-2-amine |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)=S(C)(=O)Nc1ccc(F)cn1 |
| InChI | InChI=1S/C14H13F4N3OS/c1-9(10-3-5-12(19-7-10)14(16,17)18)23(2,22)21-13-6-4-11(15)8-20-13/h3-8H,1-2H3,(H,20,21,22) |
| InChIKey | HXXYWZRDZWVWEV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|