C18H15F4N3OS2 — CID 90738479
2-[amino-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-(4-fluorophenyl)-5-methyl-1,3-thiazole (PubChem CID 90738479) has the molecular formula C18H15F4N3OS2 and a molecular weight of 429.46 g/mol. Its IUPAC name is 2-[amino-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-(4-fluorophenyl)-5-methyl-1,3-thiazole.
| Compound Name | 2-[amino-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-(4-fluorophenyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 90738479 |
| Molecular Formula | C18H15F4N3OS2 |
| Molecular Weight | 429.46 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 2-[amino-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-(4-fluorophenyl)-5-methyl-1,3-thiazole |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)=S(N)(=O)c1nc(-c2ccc(F)cc2)c(C)s1 |
| InChI | InChI=1S/C18H15F4N3OS2/c1-10-16(12-3-6-14(19)7-4-12)25-17(27-10)28(23,26)11(2)13-5-8-15(24-9-13)18(20,21)22/h3-9H,1-2H3,(H2,23,26) |
| InChIKey | KBAYBNWDFLKNLG-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.46 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|