C18H16F3N3O2S2 — CID 91616733
2-[amino-oxo-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-λ6-sulfanyl]-4-(4-methoxyphenyl)-5-methyl-1,3-thiazole (PubChem CID 91616733) has the molecular formula C18H16F3N3O2S2 and a molecular weight of 427.47 g/mol. Its IUPAC name is 2-[amino-oxo-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-λ6-sulfanyl]-4-(4-methoxyphenyl)-5-methyl-1,3-thiazole.
| Compound Name | 2-[amino-oxo-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-λ6-sulfanyl]-4-(4-methoxyphenyl)-5-methyl-1,3-thiazole |
|---|---|
| PubChem CID | 91616733 |
| Molecular Formula | C18H16F3N3O2S2 |
| Molecular Weight | 427.47 g/mol |
| Exact Mass | 427.06 |
| IUPAC Name | 2-[amino-oxo-[[6-(trifluoromethyl)-3-pyridinyl]methylidene]-λ6-sulfanyl]-4-(4-methoxyphenyl)-5-methyl-1,3-thiazole |
| SMILES | COc1ccc(-c2nc(S(N)(=O)=Cc3ccc(C(F)(F)F)nc3)sc2C)cc1 |
| InChI | InChI=1S/C18H16F3N3O2S2/c1-11-16(13-4-6-14(26-2)7-5-13)24-17(27-11)28(22,25)10-12-3-8-15(23-9-12)18(19,20)21/h3-10H,1-2H3,(H2,22,25) |
| InChIKey | ZISHLVFMXBXNJJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.47 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|