C12H11BrF3N3OS2 — CID 91399401
4-bromo-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-thiazol-2-amine (PubChem CID 91399401) has the molecular formula C12H11BrF3N3OS2 and a molecular weight of 414.27 g/mol. Its IUPAC name is 4-bromo-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-thiazol-2-amine.
| Compound Name | 4-bromo-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 91399401 |
| Molecular Formula | C12H11BrF3N3OS2 |
| Molecular Weight | 414.27 g/mol |
| Exact Mass | 412.95 |
| IUPAC Name | 4-bromo-N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-1,3-thiazol-2-amine |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)=S(C)(=O)Nc1nc(Br)cs1 |
| InChI | InChI=1S/C12H11BrF3N3OS2/c1-7(8-3-4-9(17-5-8)12(14,15)16)22(2,20)19-11-18-10(13)6-21-11/h3-6H,1-2H3,(H,18,19,20) |
| InChIKey | DQXUUSWPELCSME-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.27 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|