C18H16F3N3O2S — CID 91480387
N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-phenyl-1,3-oxazol-2-amine (PubChem CID 91480387) has the molecular formula C18H16F3N3O2S and a molecular weight of 395.41 g/mol. Its IUPAC name is N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-phenyl-1,3-oxazol-2-amine.
| Compound Name | N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-phenyl-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 91480387 |
| Molecular Formula | C18H16F3N3O2S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[methyl-oxo-[1-[6-(trifluoromethyl)-3-pyridinyl]ethylidene]-λ6-sulfanyl]-4-phenyl-1,3-oxazol-2-amine |
| SMILES | CC(c1ccc(C(F)(F)F)nc1)=S(C)(=O)Nc1nc(-c2ccccc2)co1 |
| InChI | InChI=1S/C18H16F3N3O2S/c1-12(14-8-9-16(22-10-14)18(19,20)21)27(2,25)24-17-23-15(11-26-17)13-6-4-3-5-7-13/h3-11H,1-2H3,(H,23,24,25) |
| InChIKey | FUBWJKAPJZWNNK-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 68.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|