C48H47N2+ — CID 76593847
3-methyl-2-[5-[3-methyl-1,1-bis(prop-2-enyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1-[(2-methylphenyl)methyl]-1-prop-2-enylbenzo[e]indol-3-ium (PubChem CID 76593847) has the molecular formula C48H47N2+ and a molecular weight of 651.92 g/mol. Its IUPAC name is 3-methyl-2-[5-[3-methyl-1,1-bis(prop-2-enyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1-[(2-methylphenyl)methyl]-1-prop-2-enylbenzo[e]indol-3-ium.
| Compound Name | 3-methyl-2-[5-[3-methyl-1,1-bis(prop-2-enyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1-[(2-methylphenyl)methyl]-1-prop-2-enylbenzo[e]indol-3-ium |
|---|---|
| PubChem CID | 76593847 |
| Molecular Formula | C48H47N2+ |
| Molecular Weight | 651.92 g/mol |
| Exact Mass | 651.37 |
| IUPAC Name | 3-methyl-2-[5-[3-methyl-1,1-bis(prop-2-enyl)benzo[e]indol-2-ylidene]penta-1,3-dienyl]-1-[(2-methylphenyl)methyl]-1-prop-2-enylbenzo[e]indol-3-ium |
| SMILES | C=CCC1(CC=C)C(=CC=CC=CC2=[N+](C)c3ccc4ccccc4c3C2(CC=C)Cc2ccccc2C)N(C)c2ccc3ccccc3c21 |
| InChI | InChI=1S/C48H47N2/c1-7-31-47(32-8-2)43(49(5)41-29-27-36-20-15-17-23-39(36)45(41)47)25-11-10-12-26-44-48(33-9-3,34-38-22-14-13-19-35(38)4)46-40-24-18-16-21-37(40)28-30-42(46)50(44)6/h7-30H,1-3,31-34H2,4-6H3/q+1 |
| InChIKey | HMQDDUKOMUHYCE-UHFFFAOYSA-N |
| XLogP | 11.62 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.92 |
| LogP ≤ 5 | 11.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|