C12H18O5 — CID 76626751
4-ethenyl-7-ethoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one (PubChem CID 76626751) has the molecular formula C12H18O5 and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-ethenyl-7-ethoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one.
| Compound Name | 4-ethenyl-7-ethoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
|---|---|
| PubChem CID | 76626751 |
| Molecular Formula | C12H18O5 |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-ethenyl-7-ethoxy-2,2-dimethyl-4,4a,7,7a-tetrahydrofuro[3,2-d][1,3]dioxin-6-one |
| SMILES | C=CC1OC(C)(C)OC2C(OCC)C(=O)OC12 |
| InChI | InChI=1S/C12H18O5/c1-5-7-8-9(17-12(3,4)16-7)10(14-6-2)11(13)15-8/h5,7-10H,1,6H2,2-4H3 |
| InChIKey | HGSFYYJXKNQPNE-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|