C16H18Cl3NO5 — CID 76644495
4-[1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]ethylideneamino]oxybutanoic acid (PubChem CID 76644495) has the molecular formula C16H18Cl3NO5 and a molecular weight of 410.68 g/mol. Its IUPAC name is 4-[1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]ethylideneamino]oxybutanoic acid.
| Compound Name | 4-[1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]ethylideneamino]oxybutanoic acid |
|---|---|
| PubChem CID | 76644495 |
| Molecular Formula | C16H18Cl3NO5 |
| Molecular Weight | 410.68 g/mol |
| Exact Mass | 409.03 |
| IUPAC Name | 4-[1-[3-chloro-5-(3,3-dichloroprop-2-enoxy)-2-methoxyphenyl]ethylideneamino]oxybutanoic acid |
| SMILES | COc1c(Cl)cc(OCC=C(Cl)Cl)cc1C(C)=NOCCCC(=O)O |
| InChI | InChI=1S/C16H18Cl3NO5/c1-10(20-25-6-3-4-15(21)22)12-8-11(24-7-5-14(18)19)9-13(17)16(12)23-2/h5,8-9H,3-4,6-7H2,1-2H3,(H,21,22) |
| InChIKey | IBAKCVXKZFXRGE-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 77.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.68 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|