C42H79N3 — CID 76686264
N'-(heptatriaconta-6,9,28,31-tetraen-19-ylideneamino)-N,N,N'-trimethylethane-1,2-diamine (PubChem CID 76686264) has the molecular formula C42H79N3 and a molecular weight of 626.12 g/mol. Its IUPAC name is N'-(heptatriaconta-6,9,28,31-tetraen-19-ylideneamino)-N,N,N'-trimethylethane-1,2-diamine.
| Compound Name | N'-(heptatriaconta-6,9,28,31-tetraen-19-ylideneamino)-N,N,N'-trimethylethane-1,2-diamine |
|---|---|
| PubChem CID | 76686264 |
| Molecular Formula | C42H79N3 |
| Molecular Weight | 626.12 g/mol |
| Exact Mass | 625.63 |
| IUPAC Name | N'-(heptatriaconta-6,9,28,31-tetraen-19-ylideneamino)-N,N,N'-trimethylethane-1,2-diamine |
| SMILES | CCCCCC=CCC=CCCCCCCCCC(CCCCCCCCC=CCC=CCCCCC)=NN(C)CCN(C)C |
| InChI | InChI=1S/C42H79N3/c1-6-8-10-12-14-16-18-20-22-24-26-28-30-32-34-36-38-42(43-45(5)41-40-44(3)4)39-37-35-33-31-29-27-25-23-21-19-17-15-13-11-9-7-2/h14-17,20-23H,6-13,18-19,24-41H2,1-5H3 |
| InChIKey | ZMRSJVPDLXJGJM-UHFFFAOYSA-N |
| XLogP | 13.24 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.12 |
| LogP ≤ 5 | 13.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|