C42H78N2O — CID 58069776
3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxy-N,N-dimethylpropan-1-amine (PubChem CID 58069776) has the molecular formula C42H78N2O and a molecular weight of 627.10 g/mol. Its IUPAC name is 3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 58069776 |
| Molecular Formula | C42H78N2O |
| Molecular Weight | 627.10 g/mol |
| Exact Mass | 626.61 |
| IUPAC Name | 3-[[(6Z,9Z,28Z,31Z)-heptatriaconta-6,9,28,31-tetraen-19-ylidene]amino]oxy-N,N-dimethylpropan-1-amine |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCCC(CCCCCCCC/C=C\C/C=C\CCCCC)=NOCCCN(C)C |
| InChI | InChI=1S/C42H78N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-38-42(43-45-41-37-40-44(3)4)39-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22H,5-12,17-18,23-41H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | DRWFEESNZYWTAB-KWXKLSQISA-N |
| XLogP | 13.72 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.10 |
| LogP ≤ 5 | 13.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|