C41H76N2O — CID 123954246
(18E)-N-[2-(dimethylamino)ethoxy]heptatriaconta-6,9,18,28,31-pentaen-19-amine (PubChem CID 123954246) has the molecular formula C41H76N2O and a molecular weight of 613.07 g/mol. Its IUPAC name is (18E)-N-[2-(dimethylamino)ethoxy]heptatriaconta-6,9,18,28,31-pentaen-19-amine.
| Compound Name | (18E)-N-[2-(dimethylamino)ethoxy]heptatriaconta-6,9,18,28,31-pentaen-19-amine |
|---|---|
| PubChem CID | 123954246 |
| Molecular Formula | C41H76N2O |
| Molecular Weight | 613.07 g/mol |
| Exact Mass | 612.60 |
| IUPAC Name | (18E)-N-[2-(dimethylamino)ethoxy]heptatriaconta-6,9,18,28,31-pentaen-19-amine |
| SMILES | CCCCCC=CCC=CCCCCCCC/C=C(\CCCCCCCCC=CCC=CCCCCC)NOCCN(C)C |
| InChI | InChI=1S/C41H76N2O/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-37-41(42-44-40-39-43(3)4)38-36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,37,42H,5-12,17-18,23-36,38-40H2,1-4H3/b15-13?,16-14?,21-19?,22-20?,41-37+ |
| InChIKey | IDEBWKHAYUJBGR-XPGTYZMXSA-N |
| XLogP | 12.97 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.07 |
| LogP ≤ 5 | 12.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|