C19H23N7O3 — CID 76721941
3-[[4-(cyclopropylamino)-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione (PubChem CID 76721941) has the molecular formula C19H23N7O3 and a molecular weight of 397.44 g/mol. Its IUPAC name is 3-[[4-(cyclopropylamino)-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione.
| Compound Name | 3-[[4-(cyclopropylamino)-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 76721941 |
| Molecular Formula | C19H23N7O3 |
| Molecular Weight | 397.44 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 3-[[4-(cyclopropylamino)-2-[(4-hydroxycyclohexyl)amino]pyrazolo[1,5-a][1,3,5]triazin-8-yl]methylidene]pyrrolidine-2,5-dione |
| SMILES | O=C1CC(=Cc2cnn3c(NC4CC4)nc(NC4CCC(O)CC4)nc23)C(=O)N1 |
| InChI | InChI=1S/C19H23N7O3/c27-14-5-3-12(4-6-14)21-18-24-16-11(7-10-8-15(28)23-17(10)29)9-20-26(16)19(25-18)22-13-1-2-13/h7,9,12-14,27H,1-6,8H2,(H,23,28,29)(H2,21,22,24,25) |
| InChIKey | CLDRWPDWMUVWCQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 133.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.44 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|