C17H17Cl2F3O3 — CID 76742011
ethyl 2-[4-(2,2-dichloro-3-oxocyclobutyl)phenyl]-4,4,4-trifluoro-3-methylbutanoate (PubChem CID 76742011) has the molecular formula C17H17Cl2F3O3 and a molecular weight of 397.22 g/mol. Its IUPAC name is ethyl 2-[4-(2,2-dichloro-3-oxocyclobutyl)phenyl]-4,4,4-trifluoro-3-methylbutanoate.
| Compound Name | ethyl 2-[4-(2,2-dichloro-3-oxocyclobutyl)phenyl]-4,4,4-trifluoro-3-methylbutanoate |
|---|---|
| PubChem CID | 76742011 |
| Molecular Formula | C17H17Cl2F3O3 |
| Molecular Weight | 397.22 g/mol |
| Exact Mass | 396.05 |
| IUPAC Name | ethyl 2-[4-(2,2-dichloro-3-oxocyclobutyl)phenyl]-4,4,4-trifluoro-3-methylbutanoate |
| SMILES | CCOC(=O)C(c1ccc(C2CC(=O)C2(Cl)Cl)cc1)C(C)C(F)(F)F |
| InChI | InChI=1S/C17H17Cl2F3O3/c1-3-25-15(24)14(9(2)17(20,21)22)11-6-4-10(5-7-11)12-8-13(23)16(12,18)19/h4-7,9,12,14H,3,8H2,1-2H3 |
| InChIKey | MERPIXJDXMQELI-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.22 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|