C9H8INO3-2 — CID 76763815
(2S)-2-amino-3-(3-iodo-4-oxidophenyl)propanoate (PubChem CID 76763815) has the molecular formula C9H8INO3-2 and a molecular weight of 305.07 g/mol. Its IUPAC name is (2S)-2-amino-3-(3-iodo-4-oxidophenyl)propanoate.
| Compound Name | (2S)-2-amino-3-(3-iodo-4-oxidophenyl)propanoate |
|---|---|
| PubChem CID | 76763815 |
| Molecular Formula | C9H8INO3-2 |
| Molecular Weight | 305.07 g/mol |
| Exact Mass | 304.96 |
| IUPAC Name | (2S)-2-amino-3-(3-iodo-4-oxidophenyl)propanoate |
| SMILES | N[C@@H](Cc1ccc([O-])c(I)c1)C(=O)[O-] |
| InChI | InChI=1S/C9H10INO3/c10-6-3-5(1-2-8(6)12)4-7(11)9(13)14/h1-3,7,12H,4,11H2,(H,13,14)/p-2/t7-/m0/s1 |
| InChIKey | UQTZMGFTRHFAAM-ZETCQYMHSA-L |
| XLogP | -1.02 |
| TPSA | 89.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.07 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|