C19H23N3 — CID 76764287
(2R)-1-[2-(1H-indol-3-yl)ethyl]-4-propyl-3,6-dihydro-2H-pyridine-2-carbonitrile (PubChem CID 76764287) has the molecular formula C19H23N3 and a molecular weight of 293.41 g/mol. Its IUPAC name is (2R)-1-[2-(1H-indol-3-yl)ethyl]-4-propyl-3,6-dihydro-2H-pyridine-2-carbonitrile.
| Compound Name | (2R)-1-[2-(1H-indol-3-yl)ethyl]-4-propyl-3,6-dihydro-2H-pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 76764287 |
| Molecular Formula | C19H23N3 |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.19 |
| IUPAC Name | (2R)-1-[2-(1H-indol-3-yl)ethyl]-4-propyl-3,6-dihydro-2H-pyridine-2-carbonitrile |
| SMILES | CCCC1=CCN(CCc2c[nH]c3ccccc23)[C@@H](C#N)C1 |
| InChI | InChI=1S/C19H23N3/c1-2-5-15-8-10-22(17(12-15)13-20)11-9-16-14-21-19-7-4-3-6-18(16)19/h3-4,6-8,14,17,21H,2,5,9-12H2,1H3/t17-/m1/s1 |
| InChIKey | HFFHLWACSXXAOK-QGZVFWFLSA-N |
| XLogP | 4.03 |
| TPSA | 42.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|