C25H22FNO2 — CID 76764467
methyl 2-[(1-fluoro-1,1,4-triphenylbut-3-yn-2-yl)amino]acetate (PubChem CID 76764467) has the molecular formula C25H22FNO2 and a molecular weight of 387.45 g/mol. Its IUPAC name is methyl 2-[(1-fluoro-1,1,4-triphenylbut-3-yn-2-yl)amino]acetate.
| Compound Name | methyl 2-[(1-fluoro-1,1,4-triphenylbut-3-yn-2-yl)amino]acetate |
|---|---|
| PubChem CID | 76764467 |
| Molecular Formula | C25H22FNO2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | methyl 2-[(1-fluoro-1,1,4-triphenylbut-3-yn-2-yl)amino]acetate |
| SMILES | COC(=O)CNC(C#Cc1ccccc1)C(F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H22FNO2/c1-29-24(28)19-27-23(18-17-20-11-5-2-6-12-20)25(26,21-13-7-3-8-14-21)22-15-9-4-10-16-22/h2-16,23,27H,19H2,1H3 |
| InChIKey | YCBMGZUGKDFLMU-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|