C16H19ClN2O4 — CID 76764998
ethyl 6-chloro-1-(1-hydroxy-3-methylbutan-2-yl)-4-oxo-1,5-naphthyridine-3-carboxylate (PubChem CID 76764998) has the molecular formula C16H19ClN2O4 and a molecular weight of 338.79 g/mol. Its IUPAC name is ethyl 6-chloro-1-(1-hydroxy-3-methylbutan-2-yl)-4-oxo-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 6-chloro-1-(1-hydroxy-3-methylbutan-2-yl)-4-oxo-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 76764998 |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.79 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | ethyl 6-chloro-1-(1-hydroxy-3-methylbutan-2-yl)-4-oxo-1,5-naphthyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cn(C(CO)C(C)C)c2ccc(Cl)nc2c1=O |
| InChI | InChI=1S/C16H19ClN2O4/c1-4-23-16(22)10-7-19(12(8-20)9(2)3)11-5-6-13(17)18-14(11)15(10)21/h5-7,9,12,20H,4,8H2,1-3H3 |
| InChIKey | RXBZLPWQLBFBRY-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.79 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|