C21H21ClN2O4 — CID 76790382
5-[2-(5-chloro-6-methoxy-2-pyridinyl)ethynyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one (PubChem CID 76790382) has the molecular formula C21H21ClN2O4 and a molecular weight of 400.86 g/mol. Its IUPAC name is 5-[2-(5-chloro-6-methoxy-2-pyridinyl)ethynyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one.
| Compound Name | 5-[2-(5-chloro-6-methoxy-2-pyridinyl)ethynyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 76790382 |
| Molecular Formula | C21H21ClN2O4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 5-[2-(5-chloro-6-methoxy-2-pyridinyl)ethynyl]-1-[(2,4-dimethoxyphenyl)methyl]pyrrolidin-2-one |
| SMILES | COc1ccc(CN2C(=O)CCC2C#Cc2ccc(Cl)c(OC)n2)c(OC)c1 |
| InChI | InChI=1S/C21H21ClN2O4/c1-26-17-9-4-14(19(12-17)27-2)13-24-16(8-11-20(24)25)7-5-15-6-10-18(22)21(23-15)28-3/h4,6,9-10,12,16H,8,11,13H2,1-3H3 |
| InChIKey | LVKHJKPDIAJEJB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 60.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|