C21H25N3O6S — CID 155435657
ethylsulfanyl 4-[[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidin-2-yl]methoxy]pyrimidine-5-carboxylate (PubChem CID 155435657) has the molecular formula C21H25N3O6S and a molecular weight of 447.51 g/mol. Its IUPAC name is ethylsulfanyl 4-[[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidin-2-yl]methoxy]pyrimidine-5-carboxylate.
| Compound Name | ethylsulfanyl 4-[[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidin-2-yl]methoxy]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 155435657 |
| Molecular Formula | C21H25N3O6S |
| Molecular Weight | 447.51 g/mol |
| Exact Mass | 447.15 |
| IUPAC Name | ethylsulfanyl 4-[[(2S)-1-[(2,4-dimethoxyphenyl)methyl]-5-oxopyrrolidin-2-yl]methoxy]pyrimidine-5-carboxylate |
| SMILES | CCSOC(=O)c1cncnc1OC[C@@H]1CCC(=O)N1Cc1ccc(OC)cc1OC |
| InChI | InChI=1S/C21H25N3O6S/c1-4-31-30-21(26)17-10-22-13-23-20(17)29-12-15-6-8-19(25)24(15)11-14-5-7-16(27-2)9-18(14)28-3/h5,7,9-10,13,15H,4,6,8,11-12H2,1-3H3/t15-/m0/s1 |
| InChIKey | GGLPOKMECJMHLT-HNNXBMFYSA-N |
| XLogP | 2.89 |
| TPSA | 100.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|