C27H25N3O7S2 — CID 76790812
[5-[[4-[4-[bis(formyloxymethyl)amino]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate (PubChem CID 76790812) has the molecular formula C27H25N3O7S2 and a molecular weight of 567.65 g/mol. Its IUPAC name is [5-[[4-[4-[bis(formyloxymethyl)amino]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate.
| Compound Name | [5-[[4-[4-[bis(formyloxymethyl)amino]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
|---|---|
| PubChem CID | 76790812 |
| Molecular Formula | C27H25N3O7S2 |
| Molecular Weight | 567.65 g/mol |
| Exact Mass | 567.11 |
| IUPAC Name | [5-[[4-[4-[bis(formyloxymethyl)amino]phenyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]methyl formate |
| SMILES | O=COCN1C(=O)C(=Cc2ccc3c(c2)C2CCCC2N3c2ccc(N(COC=O)COC=O)cc2)SC1=S |
| InChI | InChI=1S/C27H25N3O7S2/c31-15-35-12-28(13-36-16-32)19-5-7-20(8-6-19)30-23-3-1-2-21(23)22-10-18(4-9-24(22)30)11-25-26(34)29(14-37-17-33)27(38)39-25/h4-11,15-17,21,23H,1-3,12-14H2 |
| InChIKey | PUUBKIDUILNSDG-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.65 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|