C29H26N2O4S2 — CID 58454806
2-[(5E)-5-[[4-[6-(hydroxymethyl)naphthalen-2-yl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl formate (PubChem CID 58454806) has the molecular formula C29H26N2O4S2 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-[(5E)-5-[[4-[6-(hydroxymethyl)naphthalen-2-yl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl formate.
| Compound Name | 2-[(5E)-5-[[4-[6-(hydroxymethyl)naphthalen-2-yl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl formate |
|---|---|
| PubChem CID | 58454806 |
| Molecular Formula | C29H26N2O4S2 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.13 |
| IUPAC Name | 2-[(5E)-5-[[4-[6-(hydroxymethyl)naphthalen-2-yl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-7-yl]methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]ethyl formate |
| SMILES | O=COCCN1C(=O)/C(=C\c2ccc3c(c2)C2CCCC2N3c2ccc3cc(CO)ccc3c2)SC1=S |
| InChI | InChI=1S/C29H26N2O4S2/c32-16-19-4-6-21-15-22(8-7-20(21)12-19)31-25-3-1-2-23(25)24-13-18(5-9-26(24)31)14-27-28(34)30(29(36)37-27)10-11-35-17-33/h4-9,12-15,17,23,25,32H,1-3,10-11,16H2/b27-14+ |
| InChIKey | PODQAJZLMSLABQ-MZJWZYIUSA-N |
| XLogP | 5.49 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|