C33H29N3O4S2 — CID 118013395
methyl 4-[(E)-2-[4-[7-[(E)-[3-(2-amino-2-oxoethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]ethenyl]benzoate (PubChem CID 118013395) has the molecular formula C33H29N3O4S2 and a molecular weight of 595.75 g/mol. Its IUPAC name is methyl 4-[(E)-2-[4-[7-[(E)-[3-(2-amino-2-oxoethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]ethenyl]benzoate.
| Compound Name | methyl 4-[(E)-2-[4-[7-[(E)-[3-(2-amino-2-oxoethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]ethenyl]benzoate |
|---|---|
| PubChem CID | 118013395 |
| Molecular Formula | C33H29N3O4S2 |
| Molecular Weight | 595.75 g/mol |
| Exact Mass | 595.16 |
| IUPAC Name | methyl 4-[(E)-2-[4-[7-[(E)-[3-(2-amino-2-oxoethyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-2,3,3a,8b-tetrahydro-1H-cyclopenta[b]indol-4-yl]phenyl]ethenyl]benzoate |
| SMILES | COC(=O)c1ccc(/C=C/c2ccc(N3c4ccc(/C=C5/SC(=S)N(CC(N)=O)C5=O)cc4C4CCCC43)cc2)cc1 |
| InChI | InChI=1S/C33H29N3O4S2/c1-40-32(39)23-12-7-20(8-13-23)5-6-21-9-14-24(15-10-21)36-27-4-2-3-25(27)26-17-22(11-16-28(26)36)18-29-31(38)35(19-30(34)37)33(41)42-29/h5-18,25,27H,2-4,19H2,1H3,(H2,34,37)/b6-5+,29-18+ |
| InChIKey | AMDBDUFWJYUQAE-QUQQUXLOSA-N |
| XLogP | 6.12 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.75 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|