C21H23NO6S — CID 7679680
(7R)-8-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline (PubChem CID 7679680) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is (7R)-8-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline.
| Compound Name | (7R)-8-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 7679680 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | (7R)-8-(2,3-dihydro-1,4-benzodioxin-6-ylsulfonyl)-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
| SMILES | C[C@@H]1c2cc3c(cc2CCN1S(=O)(=O)c1ccc2c(c1)OCCO2)OCCCO3 |
| InChI | InChI=1S/C21H23NO6S/c1-14-17-13-21-19(25-7-2-8-26-21)11-15(17)5-6-22(14)29(23,24)16-3-4-18-20(12-16)28-10-9-27-18/h3-4,11-14H,2,5-10H2,1H3/t14-/m1/s1 |
| InChIKey | KDHVHXUKVUCESP-CQSZACIVSA-N |
| XLogP | 2.93 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |