C21H25NO4S — CID 7692745
(7S)-8-(2,5-dimethylphenyl)sulfonyl-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline (PubChem CID 7692745) has the molecular formula C21H25NO4S and a molecular weight of 387.50 g/mol. Its IUPAC name is (7S)-8-(2,5-dimethylphenyl)sulfonyl-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline.
| Compound Name | (7S)-8-(2,5-dimethylphenyl)sulfonyl-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 7692745 |
| Molecular Formula | C21H25NO4S |
| Molecular Weight | 387.50 g/mol |
| Exact Mass | 387.15 |
| IUPAC Name | (7S)-8-(2,5-dimethylphenyl)sulfonyl-7-methyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
| SMILES | Cc1ccc(C)c(S(=O)(=O)N2CCc3cc4c(cc3[C@@H]2C)OCCCO4)c1 |
| InChI | InChI=1S/C21H25NO4S/c1-14-5-6-15(2)21(11-14)27(23,24)22-8-7-17-12-19-20(13-18(17)16(22)3)26-10-4-9-25-19/h5-6,11-13,16H,4,7-10H2,1-3H3/t16-/m0/s1 |
| InChIKey | QVYYJTSQUPAIOH-INIZCTEOSA-N |
| XLogP | 3.77 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.50 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |