C20H23NO4S — CID 7680833
(7R)-7-methyl-8-(4-methylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline (PubChem CID 7680833) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is (7R)-7-methyl-8-(4-methylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline.
| Compound Name | (7R)-7-methyl-8-(4-methylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 7680833 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | (7R)-7-methyl-8-(4-methylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
| SMILES | Cc1ccc(S(=O)(=O)N2CCc3cc4c(cc3[C@H]2C)OCCCO4)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-14-4-6-17(7-5-14)26(22,23)21-9-8-16-12-19-20(13-18(16)15(21)2)25-11-3-10-24-19/h4-7,12-13,15H,3,8-11H2,1-2H3/t15-/m1/s1 |
| InChIKey | CAQLBZIBOZJQKO-OAHLLOKOSA-N |
| XLogP | 3.46 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |