C23H29NO4S — CID 7679257
(7R)-7-methyl-8-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline (PubChem CID 7679257) has the molecular formula C23H29NO4S and a molecular weight of 415.56 g/mol. Its IUPAC name is (7R)-7-methyl-8-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline.
| Compound Name | (7R)-7-methyl-8-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
|---|---|
| PubChem CID | 7679257 |
| Molecular Formula | C23H29NO4S |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.18 |
| IUPAC Name | (7R)-7-methyl-8-(2,3,5,6-tetramethylphenyl)sulfonyl-2,3,4,7,9,10-hexahydro-[1,4]dioxepino[2,3-g]isoquinoline |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)N2CCc3cc4c(cc3[C@H]2C)OCCCO4)c1C |
| InChI | InChI=1S/C23H29NO4S/c1-14-11-15(2)17(4)23(16(14)3)29(25,26)24-8-7-19-12-21-22(13-20(19)18(24)5)28-10-6-9-27-21/h11-13,18H,6-10H2,1-5H3/t18-/m1/s1 |
| InChIKey | ZUNNPCIBJPQIJF-GOSISDBHSA-N |
| XLogP | 4.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |