C30H32F6O4 — CID 76827244
methyl 3-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]prop-2-enoate (PubChem CID 76827244) has the molecular formula C30H32F6O4 and a molecular weight of 570.57 g/mol. Its IUPAC name is methyl 3-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76827244 |
| Molecular Formula | C30H32F6O4 |
| Molecular Weight | 570.57 g/mol |
| Exact Mass | 570.22 |
| IUPAC Name | methyl 3-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenyl]prop-2-enoate |
| SMILES | CCC(CC)(c1ccc(C#CC(OCOC)(C(F)(F)F)C(F)(F)F)c(C)c1)c1ccc(C=CC(=O)OC)c(C)c1 |
| InChI | InChI=1S/C30H32F6O4/c1-7-27(8-2,24-12-9-22(20(3)17-24)11-14-26(37)39-6)25-13-10-23(21(4)18-25)15-16-28(29(31,32)33,30(34,35)36)40-19-38-5/h9-14,17-18H,7-8,19H2,1-6H3 |
| InChIKey | BEXIPPPKQAYIFK-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.57 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|