C38H52F6O6Si — CID 87788281
ethyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]butanoate (PubChem CID 87788281) has the molecular formula C38H52F6O6Si and a molecular weight of 746.90 g/mol. Its IUPAC name is ethyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]butanoate.
| Compound Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]butanoate |
|---|---|
| PubChem CID | 87788281 |
| Molecular Formula | C38H52F6O6Si |
| Molecular Weight | 746.90 g/mol |
| Exact Mass | 746.34 |
| IUPAC Name | ethyl 3-[tert-butyl(dimethyl)silyl]oxy-4-[2-methyl-4-[3-[3-methyl-4-[4,4,4-trifluoro-3-(methoxymethoxy)-3-(trifluoromethyl)but-1-ynyl]phenyl]pentan-3-yl]phenoxy]butanoate |
| SMILES | CCOC(=O)CC(COc1ccc(C(CC)(CC)c2ccc(C#CC(OCOC)(C(F)(F)F)C(F)(F)F)c(C)c2)cc1C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C38H52F6O6Si/c1-12-35(13-2,29-16-15-28(26(4)21-29)19-20-36(37(39,40)41,38(42,43)44)49-25-46-9)30-17-18-32(27(5)22-30)48-24-31(23-33(45)47-14-3)50-51(10,11)34(6,7)8/h15-18,21-22,31H,12-14,23-25H2,1-11H3 |
| InChIKey | QSWQPJDVEIWEFK-UHFFFAOYSA-N |
| XLogP | 9.97 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 746.90 |
| LogP ≤ 5 | 9.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|