C26H29N3O2 — CID 76838229
3-[1-[cyclopropylmethyl(2-indol-1-ylethyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide (PubChem CID 76838229) has the molecular formula C26H29N3O2 and a molecular weight of 415.54 g/mol. Its IUPAC name is 3-[1-[cyclopropylmethyl(2-indol-1-ylethyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide.
| Compound Name | 3-[1-[cyclopropylmethyl(2-indol-1-ylethyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
|---|---|
| PubChem CID | 76838229 |
| Molecular Formula | C26H29N3O2 |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.23 |
| IUPAC Name | 3-[1-[cyclopropylmethyl(2-indol-1-ylethyl)amino]-2,3-dihydro-1H-inden-5-yl]-N-hydroxyprop-2-enamide |
| SMILES | O=C(C=Cc1ccc2c(c1)CCC2N(CCn1ccc2ccccc21)CC1CC1)NO |
| InChI | InChI=1S/C26H29N3O2/c30-26(27-31)12-8-19-7-10-23-22(17-19)9-11-25(23)29(18-20-5-6-20)16-15-28-14-13-21-3-1-2-4-24(21)28/h1-4,7-8,10,12-14,17,20,25,31H,5-6,9,11,15-16,18H2,(H,27,30) |
| InChIKey | BYWLQVASVSALNT-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 57.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|