C7H8N4 — CID 76847172
2H-pyrazolo[4,3-c]pyridin-3-ylmethanamine (PubChem CID 76847172) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is 2H-pyrazolo[4,3-c]pyridin-3-ylmethanamine.
| Compound Name | 2H-pyrazolo[4,3-c]pyridin-3-ylmethanamine |
|---|---|
| PubChem CID | 76847172 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | 2H-pyrazolo[4,3-c]pyridin-3-ylmethanamine |
| SMILES | NCc1[nH]nc2ccncc12 |
| InChI | InChI=1S/C7H8N4/c8-3-7-5-4-9-2-1-6(5)10-11-7/h1-2,4H,3,8H2,(H,10,11) |
| InChIKey | XYJYDAOMZQMTCW-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |