C20H29N2O6P — CID 7689586
tert-butyl-(2-ethoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane (PubChem CID 7689586) has the molecular formula C20H29N2O6P and a molecular weight of 424.43 g/mol. Its IUPAC name is tert-butyl-(2-ethoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane.
| Compound Name | tert-butyl-(2-ethoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane |
|---|---|
| PubChem CID | 7689586 |
| Molecular Formula | C20H29N2O6P |
| Molecular Weight | 424.43 g/mol |
| Exact Mass | 424.18 |
| IUPAC Name | tert-butyl-(2-ethoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane |
| SMILES | CCOCCO[P@](=Nc1cc([N+](=O)[O-])ccc1OC)(c1ccc(C)o1)C(C)(C)C |
| InChI | InChI=1S/C20H29N2O6P/c1-7-26-12-13-27-29(20(3,4)5,19-11-8-15(2)28-19)21-17-14-16(22(23)24)9-10-18(17)25-6/h8-11,14H,7,12-13H2,1-6H3/t29-/m1/s1 |
| InChIKey | VWFGSELDZIDUSY-GDLZYMKVSA-N |
| XLogP | 5.43 |
| TPSA | 96.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.43 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|