C19H27N2O6P — CID 7689522
tert-butyl-(2-methoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane (PubChem CID 7689522) has the molecular formula C19H27N2O6P and a molecular weight of 410.41 g/mol. Its IUPAC name is tert-butyl-(2-methoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane.
| Compound Name | tert-butyl-(2-methoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane |
|---|---|
| PubChem CID | 7689522 |
| Molecular Formula | C19H27N2O6P |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | tert-butyl-(2-methoxyethoxy)-(2-methoxy-5-nitrophenyl)imino-(5-methylfuran-2-yl)-λ5-phosphane |
| SMILES | COCCO[P@](=Nc1cc([N+](=O)[O-])ccc1OC)(c1ccc(C)o1)C(C)(C)C |
| InChI | InChI=1S/C19H27N2O6P/c1-14-7-10-18(27-14)28(19(2,3)4,26-12-11-24-5)20-16-13-15(21(22)23)8-9-17(16)25-6/h7-10,13H,11-12H2,1-6H3/t28-/m1/s1 |
| InChIKey | JZYRAIBJAREGHY-MUUNZHRXSA-N |
| XLogP | 5.04 |
| TPSA | 96.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|