C22H22Br2N3O4P — CID 4224578
tert-butyl-(2,4-dibromophenoxy)-(2-methoxy-5-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane (PubChem CID 4224578) has the molecular formula C22H22Br2N3O4P and a molecular weight of 583.22 g/mol. Its IUPAC name is tert-butyl-(2,4-dibromophenoxy)-(2-methoxy-5-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane.
| Compound Name | tert-butyl-(2,4-dibromophenoxy)-(2-methoxy-5-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane |
|---|---|
| PubChem CID | 4224578 |
| Molecular Formula | C22H22Br2N3O4P |
| Molecular Weight | 583.22 g/mol |
| Exact Mass | 580.97 |
| IUPAC Name | tert-butyl-(2,4-dibromophenoxy)-(2-methoxy-5-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane |
| SMILES | COc1ccc([N+](=O)[O-])cc1N=P(Oc1ccc(Br)cc1Br)(c1ccncc1)C(C)(C)C |
| InChI | InChI=1S/C22H22Br2N3O4P/c1-22(2,3)32(17-9-11-25-12-10-17,31-20-7-5-15(23)13-18(20)24)26-19-14-16(27(28)29)6-8-21(19)30-4/h5-14H,1-4H3 |
| InChIKey | LEURASKLDJJWRG-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 86.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.22 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|