C21H20Br2N3O3P — CID 4070185
tert-butyl-(2,4-dibromophenoxy)-(2-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane (PubChem CID 4070185) has the molecular formula C21H20Br2N3O3P and a molecular weight of 553.19 g/mol. Its IUPAC name is tert-butyl-(2,4-dibromophenoxy)-(2-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane.
| Compound Name | tert-butyl-(2,4-dibromophenoxy)-(2-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane |
|---|---|
| PubChem CID | 4070185 |
| Molecular Formula | C21H20Br2N3O3P |
| Molecular Weight | 553.19 g/mol |
| Exact Mass | 550.96 |
| IUPAC Name | tert-butyl-(2,4-dibromophenoxy)-(2-nitrophenyl)imino-pyridin-4-yl-λ5-phosphane |
| SMILES | CC(C)(C)P(=Nc1ccccc1[N+](=O)[O-])(Oc1ccc(Br)cc1Br)c1ccncc1 |
| InChI | InChI=1S/C21H20Br2N3O3P/c1-21(2,3)30(16-10-12-24-13-11-16,29-20-9-8-15(22)14-17(20)23)25-18-6-4-5-7-19(18)26(27)28/h4-14H,1-3H3 |
| InChIKey | KDCGPDCPKIZWEV-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 77.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.19 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|