C10H12F2N2OS — CID 76915909
2-(3,4-difluorophenyl)sulfanyl-N'-hydroxybutanimidamide (PubChem CID 76915909) has the molecular formula C10H12F2N2OS and a molecular weight of 246.28 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N'-hydroxybutanimidamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N'-hydroxybutanimidamide |
|---|---|
| PubChem CID | 76915909 |
| Molecular Formula | C10H12F2N2OS |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N'-hydroxybutanimidamide |
| SMILES | CCC(Sc1ccc(F)c(F)c1)C(N)=NO |
| InChI | InChI=1S/C10H12F2N2OS/c1-2-9(10(13)14-15)16-6-3-4-7(11)8(12)5-6/h3-5,9,15H,2H2,1H3,(H2,13,14) |
| InChIKey | UFPANZYUFACMDD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 58.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|