C18H22N4O6 — CID 7691908
2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(tert-butylcarbamoyl)acetamide (PubChem CID 7691908) has the molecular formula C18H22N4O6 and a molecular weight of 390.40 g/mol. Its IUPAC name is 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(tert-butylcarbamoyl)acetamide.
| Compound Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(tert-butylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 7691908 |
| Molecular Formula | C18H22N4O6 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.15 |
| IUPAC Name | 2-[(4S)-4-(1,3-benzodioxol-5-yl)-4-methyl-2,5-dioxoimidazolidin-1-yl]-N-(tert-butylcarbamoyl)acetamide |
| SMILES | CC(C)(C)NC(=O)NC(=O)CN1C(=O)N[C@@](C)(c2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C18H22N4O6/c1-17(2,3)20-15(25)19-13(23)8-22-14(24)18(4,21-16(22)26)10-5-6-11-12(7-10)28-9-27-11/h5-7H,8-9H2,1-4H3,(H,21,26)(H2,19,20,23,25)/t18-/m0/s1 |
| InChIKey | CTPHKYVMGAHIHR-SFHVURJKSA-N |
| XLogP | 0.81 |
| TPSA | 126.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|