C20H13FN4OS — CID 7692806
3-[(4-fluoro-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)methyl]benzonitrile (PubChem CID 7692806) has the molecular formula C20H13FN4OS and a molecular weight of 376.42 g/mol. Its IUPAC name is 3-[(4-fluoro-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)methyl]benzonitrile.
| Compound Name | 3-[(4-fluoro-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)methyl]benzonitrile |
|---|---|
| PubChem CID | 7692806 |
| Molecular Formula | C20H13FN4OS |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | 3-[(4-fluoro-10-oxo-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-8-yl)methyl]benzonitrile |
| SMILES | N#Cc1cccc(Cn2c3ccc(F)cc3c3nc4n(c(=O)c32)CCS4)c1 |
| InChI | InChI=1S/C20H13FN4OS/c21-14-4-5-16-15(9-14)17-18(19(26)24-6-7-27-20(24)23-17)25(16)11-13-3-1-2-12(8-13)10-22/h1-5,8-9H,6-7,11H2 |
| InChIKey | LJADTZXWMQRAFP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 63.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |