C20H16FN3O2S — CID 7708870
8-[(3-fluorophenyl)methyl]-4-methoxy-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-10-one (PubChem CID 7708870) has the molecular formula C20H16FN3O2S and a molecular weight of 381.43 g/mol. Its IUPAC name is 8-[(3-fluorophenyl)methyl]-4-methoxy-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-10-one.
| Compound Name | 8-[(3-fluorophenyl)methyl]-4-methoxy-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-10-one |
|---|---|
| PubChem CID | 7708870 |
| Molecular Formula | C20H16FN3O2S |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.09 |
| IUPAC Name | 8-[(3-fluorophenyl)methyl]-4-methoxy-14-thia-8,11,16-triazatetracyclo[7.7.0.02,7.011,15]hexadeca-1(9),2(7),3,5,15-pentaen-10-one |
| SMILES | COc1ccc2c(c1)c1nc3n(c(=O)c1n2Cc1cccc(F)c1)CCS3 |
| InChI | InChI=1S/C20H16FN3O2S/c1-26-14-5-6-16-15(10-14)17-18(19(25)23-7-8-27-20(23)22-17)24(16)11-12-3-2-4-13(21)9-12/h2-6,9-10H,7-8,11H2,1H3 |
| InChIKey | ICUWMXJBVWSRKH-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 49.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |