C13H18N2O — CID 76938434
N-[(6-but-2-enoxy-3-pyridinyl)methyl]cyclopropanamine (PubChem CID 76938434) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is N-[(6-but-2-enoxy-3-pyridinyl)methyl]cyclopropanamine.
| Compound Name | N-[(6-but-2-enoxy-3-pyridinyl)methyl]cyclopropanamine |
|---|---|
| PubChem CID | 76938434 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | N-[(6-but-2-enoxy-3-pyridinyl)methyl]cyclopropanamine |
| SMILES | CC=CCOc1ccc(CNC2CC2)cn1 |
| InChI | InChI=1S/C13H18N2O/c1-2-3-8-16-13-7-4-11(10-15-13)9-14-12-5-6-12/h2-4,7,10,12,14H,5-6,8-9H2,1H3 |
| InChIKey | KATLRWQXHHXADH-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|