C11H17NO4 — CID 76946471
4-[[1-(hydroxymethyl)cyclohexyl]amino]-4-oxobut-2-enoic acid (PubChem CID 76946471) has the molecular formula C11H17NO4 and a molecular weight of 227.26 g/mol. Its IUPAC name is 4-[[1-(hydroxymethyl)cyclohexyl]amino]-4-oxobut-2-enoic acid.
| Compound Name | 4-[[1-(hydroxymethyl)cyclohexyl]amino]-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 76946471 |
| Molecular Formula | C11H17NO4 |
| Molecular Weight | 227.26 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 4-[[1-(hydroxymethyl)cyclohexyl]amino]-4-oxobut-2-enoic acid |
| SMILES | O=C(O)C=CC(=O)NC1(CO)CCCCC1 |
| InChI | InChI=1S/C11H17NO4/c13-8-11(6-2-1-3-7-11)12-9(14)4-5-10(15)16/h4-5,13H,1-3,6-8H2,(H,12,14)(H,15,16) |
| InChIKey | MVKLOKZKFLMUKP-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.26 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|