About CID 76954965
CID 76954965 (PubChem CID 76954965) has the molecular formula C18H20BBrP
and a molecular weight of 358.05 g/mol.
Molecular Properties
| Compound Name | CID 76954965 |
| PubChem CID | 76954965 |
| Molecular Formula | C18H20BBrP |
| Molecular Weight | 358.05 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | — |
| SMILES | Brc1ccccc1P(c1ccccc1)C1CCCCC1.[B] |
| InChI | InChI=1S/C18H20BrP.B/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h1,3-4,7-10,13-14,16H,2,5-6,11-12H2; |
| InChIKey | FIBXELRLXHAZLP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 76954965 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 76954965?
The IUPAC name of CID 76954965 (CID 76954965) is not available.
What is the SMILES notation for CID 76954965?
The canonical SMILES for CID 76954965 is Brc1ccccc1P(c1ccccc1)C1CCCCC1.[B].
What is the InChIKey of CID 76954965?
The InChIKey is FIBXELRLXHAZLP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20BrP.B/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h1,3-4,7-10,13-14,16H,2,5-6,11-12H2;.
What are the key properties of CID 76954965?
CID 76954965 has a molecular weight of 358.05 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 76954965 is sourced from PubChem (CID 76954965), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).