C18H20BBrP — CID 76954965
CID 76954965 (PubChem CID 76954965) has the molecular formula C18H20BBrP and a molecular weight of 358.05 g/mol.
| Compound Name | CID 76954965 |
|---|---|
| PubChem CID | 76954965 |
| Molecular Formula | C18H20BBrP |
| Molecular Weight | 358.05 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | — |
| SMILES | Brc1ccccc1P(c1ccccc1)C1CCCCC1.[B] |
| InChI | InChI=1S/C18H20BrP.B/c19-17-13-7-8-14-18(17)20(15-9-3-1-4-10-15)16-11-5-2-6-12-16;/h1,3-4,7-10,13-14,16H,2,5-6,11-12H2; |
| InChIKey | FIBXELRLXHAZLP-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.05 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|