C43H56P2 — CID 175362928
tert-butyl-[3-[cyclohexyl(phenyl)phosphanyl]-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenylphosphane (PubChem CID 175362928) has the molecular formula C43H56P2 and a molecular weight of 634.87 g/mol. Its IUPAC name is tert-butyl-[3-[cyclohexyl(phenyl)phosphanyl]-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenylphosphane.
| Compound Name | tert-butyl-[3-[cyclohexyl(phenyl)phosphanyl]-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenylphosphane |
|---|---|
| PubChem CID | 175362928 |
| Molecular Formula | C43H56P2 |
| Molecular Weight | 634.87 g/mol |
| Exact Mass | 634.39 |
| IUPAC Name | tert-butyl-[3-[cyclohexyl(phenyl)phosphanyl]-2-[2,4,6-tri(propan-2-yl)phenyl]phenyl]-phenylphosphane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2c(P(c3ccccc3)C3CCCCC3)cccc2P(c2ccccc2)C(C)(C)C)c(C(C)C)c1 |
| InChI | InChI=1S/C43H56P2/c1-30(2)33-28-37(31(3)4)41(38(29-33)32(5)6)42-39(44(34-20-13-10-14-21-34)35-22-15-11-16-23-35)26-19-27-40(42)45(43(7,8)9)36-24-17-12-18-25-36/h10,12-14,17-21,24-32,35H,11,15-16,22-23H2,1-9H3 |
| InChIKey | AVEWNIYFMNYTHJ-UHFFFAOYSA-N |
| XLogP | 11.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.87 |
| LogP ≤ 5 | 11.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|