C16H13ClF3NO2 — CID 76962654
ethyl 5-chloro-2-(cyclobuten-1-yl)-3-(trifluoromethyl)indole-1-carboxylate (PubChem CID 76962654) has the molecular formula C16H13ClF3NO2 and a molecular weight of 343.73 g/mol. Its IUPAC name is ethyl 5-chloro-2-(cyclobuten-1-yl)-3-(trifluoromethyl)indole-1-carboxylate.
| Compound Name | ethyl 5-chloro-2-(cyclobuten-1-yl)-3-(trifluoromethyl)indole-1-carboxylate |
|---|---|
| PubChem CID | 76962654 |
| Molecular Formula | C16H13ClF3NO2 |
| Molecular Weight | 343.73 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | ethyl 5-chloro-2-(cyclobuten-1-yl)-3-(trifluoromethyl)indole-1-carboxylate |
| SMILES | CCOC(=O)n1c(C2=CCC2)c(C(F)(F)F)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C16H13ClF3NO2/c1-2-23-15(22)21-12-7-6-10(17)8-11(12)13(16(18,19)20)14(21)9-4-3-5-9/h4,6-8H,2-3,5H2,1H3 |
| InChIKey | VSADVAHNRBTTNR-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.73 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |