C9H15N3O2 — CID 76998363
2-(1-aminopropyl)-5-ethyl-1H-pyrimidine-4,6-dione (PubChem CID 76998363) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 2-(1-aminopropyl)-5-ethyl-1H-pyrimidine-4,6-dione.
| Compound Name | 2-(1-aminopropyl)-5-ethyl-1H-pyrimidine-4,6-dione |
|---|---|
| PubChem CID | 76998363 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 2-(1-aminopropyl)-5-ethyl-1H-pyrimidine-4,6-dione |
| SMILES | CCC(N)C1=NC(=O)C(CC)C(=O)N1 |
| InChI | InChI=1S/C9H15N3O2/c1-3-5-8(13)11-7(6(10)4-2)12-9(5)14/h5-6H,3-4,10H2,1-2H3,(H,11,12,13,14) |
| InChIKey | WGTKNHHQAIMTAU-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|