C11H17NO3 — CID 121218732
3,3,5-triethylpiperidine-2,4,6-trione (PubChem CID 121218732) has the molecular formula C11H17NO3 and a molecular weight of 211.26 g/mol. Its IUPAC name is 3,3,5-triethylpiperidine-2,4,6-trione.
| Compound Name | 3,3,5-triethylpiperidine-2,4,6-trione |
|---|---|
| PubChem CID | 121218732 |
| Molecular Formula | C11H17NO3 |
| Molecular Weight | 211.26 g/mol |
| Exact Mass | 211.12 |
| IUPAC Name | 3,3,5-triethylpiperidine-2,4,6-trione |
| SMILES | CCC1C(=O)NC(=O)C(CC)(CC)C1=O |
| InChI | InChI=1S/C11H17NO3/c1-4-7-8(13)11(5-2,6-3)10(15)12-9(7)14/h7H,4-6H2,1-3H3,(H,12,14,15) |
| InChIKey | GLOGKFKYXRMIMG-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.26 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|